cas: 117292-80-5 — see every product listed under this CAS number, including other names
(E)-Phenethyl 3-(3-hydroxy-4-methoxyphenyl)acrylate (CAS 117292-80-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 25mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F499134-50MG |
| cas | 117292-80-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1200.64 Pln | |
| Fluorochem | 250mg | 3850.75 Pln | |
| Fluorochem | 25mg | 799.74 Pln |
| delivery time | 3-4 weeks |
|---|
2-phenylethyl (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (CAS 117292-80-5) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: 2-phenylethyl (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate. InChIKey: LDEGDBUJVGNJEU-CSKARUKUSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 2-phenylethyl (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| InChIKey | LDEGDBUJVGNJEU-CSKARUKUSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)OCCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)