cas: 63628-26-2 — see every product listed under this CAS number, including other names
(R)-(-)-2-Methoxy-2-(1-naphthyl)propionic Acid, 99.0%, 99.0% (CAS 63628-26-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EADF-100mg |
| cas | 63628-26-2 |
| size | 100mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln |
| purity | 99.0% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-methoxy-2-naphthalen-1-ylpropanoic acid (CAS 63628-26-2) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: (2R)-2-methoxy-2-naphthalen-1-ylpropanoic acid. InChIKey: YVWMPILNFZOQSZ-CQSZACIVSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2R)-2-methoxy-2-naphthalen-1-ylpropanoic acid |
| InChIKey | YVWMPILNFZOQSZ-CQSZACIVSA-N |
| SMILES | C[C@@](C1=CC=CC2=CC=CC=C21)(C(=O)O)OC |
Computed by PubChem (NCBI)