CAS 63628-26-2 appears in our catalog under these names: (R)–(–)–2–Methoxy–2–(1–naphthyl)propionic Acid, (R)-(-)-2-Methoxy-2-(1-naphthyl)propionic acid, 95%, (R)-2-Methoxy-2-(naphthalen-1-yl)propanoic acid, 98%, (R)-(-)-2-Methoxy-2-(1-naphthyl)propionic Acid, >99.0%(HPLC), (R)-(-)-2-Methoxy-2-(1-naphthyl)propionic Acid, 99.0%, 99.0%. Offered by: GLPBio, Combi-blocks, AmBeed, TCI, Chemat. Available pack sizes: 100mg, 500mg, 250mg, 1g.
(2R)-2-methoxy-2-naphthalen-1-ylpropanoic acid (CAS 63628-26-2) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: (2R)-2-methoxy-2-naphthalen-1-ylpropanoic acid. InChIKey: YVWMPILNFZOQSZ-CQSZACIVSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2R)-2-methoxy-2-naphthalen-1-ylpropanoic acid |
| InChIKey | YVWMPILNFZOQSZ-CQSZACIVSA-N |
| SMILES | C[C@@](C1=CC=CC2=CC=CC=C21)(C(=O)O)OC |
Computed by PubChem (NCBI)