(R)-(-)-Sodium 3-hydroxybutyrate, 99%
cas: 13613-65-5 — see every product listed under this CAS number, including other names
(R)-(-)-Sodium 3-hydroxybutyrate, 99% (CAS 13613-65-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143DL-1g |
| cas | 13613-65-5 |
| size | 1g |
| availability | 1241.46g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 50g | 126.80 Pln | |
| Chemat | 100g | 179.60 Pln | |
| Chemat | 250g | 352.40 Pln | |
| Chemat | 500g | 686.40 Pln | |
| Chemat | 1kg | 1134.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Sodium (3R)-3-hydroxybutanoate (CAS 13613-65-5) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 126.09 g/mol. IUPAC name: sodium (3R)-3-hydroxybutanoate. InChIKey: NBPUSGBJDWCHKC-AENDTGMFSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 126.09 g/mol |
| IUPAC name | sodium (3R)-3-hydroxybutanoate |
| InChIKey | NBPUSGBJDWCHKC-AENDTGMFSA-M |
| SMILES | C[C@H](CC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Sodium (R)-3-hydroxybutanoate, (R)-(-)-Sodium 3-hydroxybutyrate, (R)-(-)-3-Hydroxybutyric acid sodium salt, sodium;(3R)-3-hydroxybutanoate, sodium (3R)-3-hydroxybutanoate, (R)-3-Hydroxybutanoic acid sodium, C4H7NaO3, (R)-3-Hydroxybutanoic acid (sodium), (R)-(-)-3-Hydroxybutyric Acid Sodium Salt, (R)-3-hydroxybutyric acid sodium