Products 287111-43-7
CAS 287111-43-7 appears in our catalog under these names: rac 3-Hydroxybutyric Acid-13C4 Sodium Salt, rac 3-Hydroxybutyric Acid-13C4 Sodium Salt, 3–Hydroxybutyric acid–13C4 sodium, rac 3-Hydroxybutyric acid-13C4 sodium, 3-Hydroxybutyric acid-13C4 (sodium), 98.0%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 100 μg, 5 mg, 500 μg, 1 mg.
Sodium 3-hydroxy(413C)butanoate (CAS 287111-43-7) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 127.08 g/mol. IUPAC name: sodium 3-hydroxy(413C)butanoate. InChIKey: NBPUSGBJDWCHKC-YTBWXGASSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 127.08 g/mol |
| IUPAC name | sodium 3-hydroxy(413C)butanoate |
| InChIKey | NBPUSGBJDWCHKC-YTBWXGASSA-M |
| SMILES | [13CH3]C(CC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)