CAS 202114-54-3 appears in our catalog under these names: (R)–3–Hydroxybutanoic acid–13C2 sodium, (R)-3-Hydroxybutanoic acid-13C2 (sodium), 98.0%, (R)-3-Hydroxybutanoic acid-13C2 (sodium), 98.0%, 98.0%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 100 mg, 25 mg, 10 mg, 5 mg.
Sodium (3R)-3-hydroxy(2,4-13C2)butanoate (CAS 202114-54-3) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 128.07 g/mol. IUPAC name: sodium (3R)-3-hydroxy(2,4-13C2)butanoate. InChIKey: NBPUSGBJDWCHKC-WGJKDMNVSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 128.07 g/mol |
| IUPAC name | sodium (3R)-3-hydroxy(2,4-13C2)butanoate |
| InChIKey | NBPUSGBJDWCHKC-WGJKDMNVSA-M |
| SMILES | [13CH3][C@H]([13CH2]C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)