cas: 106268-96-6 — see every product listed under this CAS number, including other names
(R)-(2-Methyloxiran-2-yl)methyl 4-nitrobenzoate, 97% (CAS 106268-96-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F790951-1G |
| cas | 106268-96-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 351.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate (CAS 106268-96-6) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: [(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate. InChIKey: PUBTVFBOTFDPTA-NSHDSACASA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | [(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate |
| InChIKey | PUBTVFBOTFDPTA-NSHDSACASA-N |
| SMILES | C[C@@]1(CO1)COC(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)