CAS 17055-07-1 is the registry number for Beta-nitroisomyristicin, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
4-methoxy-6-(2-nitroprop-1-enyl)-1,3-benzodioxole (CAS 17055-07-1) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: 4-methoxy-6-(2-nitroprop-1-enyl)-1,3-benzodioxole. InChIKey: URIZGFKLZDNSIH-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | 4-methoxy-6-(2-nitroprop-1-enyl)-1,3-benzodioxole |
| InChIKey | URIZGFKLZDNSIH-UHFFFAOYSA-N |
| SMILES | CC(=CC1=CC2=C(C(=C1)OC)OCO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)