CAS 106268-96-6 appears in our catalog under these names: (2R)-(-)-2-Methylglycidyl 4-nitrobenzoate, 95%, (R)-(-)-2-Methylglycidyl 4-Nitrobenzoate, (R)-(2-Methyloxiran-2-yl)methyl 4-nitrobenzoate 95%, (R)-(2-Methyloxiran-2-yl)methyl 4-nitrobenzoate, 97%, 97%, (R)-(2-Methyloxiran-2-yl)methyl 4-nitrobenzoate, 97%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 250mg.
[(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate (CAS 106268-96-6) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: [(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate. InChIKey: PUBTVFBOTFDPTA-NSHDSACASA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | [(2R)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate |
| InChIKey | PUBTVFBOTFDPTA-NSHDSACASA-N |
| SMILES | C[C@@]1(CO1)COC(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)