CAS 61227-18-7 appears in our catalog under these names: 3,5-Diacetoxybenzamide, 95%, 3,5-Diacetoxybenzamide, 3,5-Diacetoxybenzamide, min. 95 %, 5 g, 3,5-Diacetoxybenzamide, min. 95 %, 10 g, 3,5-Diacetoxybenzamide, min. 95 %, 25 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 25g, 10g, 5g.
(3-acetyloxy-5-carbamoylphenyl) acetate (CAS 61227-18-7) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: (3-acetyloxy-5-carbamoylphenyl) acetate. InChIKey: LDCLQPTWMZMFOD-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | (3-acetyloxy-5-carbamoylphenyl) acetate |
| InChIKey | LDCLQPTWMZMFOD-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)C(=O)N)OC(=O)C |
Computed by PubChem (NCBI)