CAS 276697-73-5 is the registry number for Carbonic acid cyclopropylmethyl ester 4-nitro-phenyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Cyclopropylmethyl (4-nitrophenyl) carbonate (CAS 276697-73-5) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: cyclopropylmethyl (4-nitrophenyl) carbonate. InChIKey: MFEOUENFAXRSKP-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | cyclopropylmethyl (4-nitrophenyl) carbonate |
| InChIKey | MFEOUENFAXRSKP-UHFFFAOYSA-N |
| SMILES | C1CC1COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)