CAS 118200-96-7 appears in our catalog under these names: (2S)-(+)-2-Methylglycidyl 4-nitrobenzoate, 95%, (2S)-(+)-2-methylglycidyl4-nitrobenzoate, 95%, (2S)-(+)-2-Methylglycidyl 4-nitrobenzoate, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
[(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate (CAS 118200-96-7) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: [(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate. InChIKey: PUBTVFBOTFDPTA-LLVKDONJSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | [(2S)-2-methyloxiran-2-yl]methyl 4-nitrobenzoate |
| InChIKey | PUBTVFBOTFDPTA-LLVKDONJSA-N |
| SMILES | C[C@]1(CO1)COC(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)