cas: 215178-45-3 — see every product listed under this CAS number, including other names
(R)-(9H-Fluoren-9-yl)methyl 2-(hydroxymethyl)pyrrolidine-1-carboxylate, 95% (CAS 215178-45-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F445591-1G |
| cas | 215178-45-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 752.88 Pln | |
| Fluorochem | 5g | 2101.36 Pln | |
| Fluorochem | 10g | 3324.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 215178-45-3) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: HJUXXCOVGMCKQL-CQSZACIVSA-N.
| Molecular formula | C20H21NO3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | HJUXXCOVGMCKQL-CQSZACIVSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CO |
Computed by PubChem (NCBI)