(R)-1-(2,6-Dimethylphenoxy)propan-2-amine hydrochloride, 95%
cas: 81771-86-0 — see every product listed under this CAS number, including other names
(R)-1-(2,6-Dimethylphenoxy)propan-2-amine hydrochloride, 95% (CAS 81771-86-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: BLDpharm, Chemat, Fluorochem.
| brand | BLDpharm |
|---|---|
| catalog number | BD756553-50mg |
| cas | 81771-86-0 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 50mg | 1141.84 Pln | |
| BLDpharm | 100mg | 1730.53 Pln | |
| BLDpharm | 250mg | 3407.71 Pln | |
| BLDpharm | 1g | 8289.33 Pln | |
| Chemat | 50mg | 1067.60 Pln | |
| Chemat | 100mg | 1614.80 Pln | |
| Chemat | 250mg | 3179.60 Pln | |
| Chemat | 1g | 7739.60 Pln | |
| Fluorochem | 100mg | 3007.29 Pln | |
| Fluorochem | 250mg | 5896.90 Pln | |
| Fluorochem | 1g | 14128.38 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride (CAS 81771-86-0) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: (2R)-1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride. InChIKey: NFEIBWMZVIVJLQ-HNCPQSOCSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | (2R)-1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride |
| InChIKey | NFEIBWMZVIVJLQ-HNCPQSOCSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC[C@@H](C)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-1-(2,6-Dimethylphenoxy)propan-2-amine hydrochloride, (-)-(R)-Mexiletine Hydrochloride, Mexiletine hydrochloride, (R)-, Mexiletine hydrochloride, (-)-, R-(-)-Mexiletine Hydrochloride, [(2R)-1-(2,6-Dimethylphenoxy)propan-2-yl]azanium;chloride, (2R)-1-(2,6-Dimethylphenoxy)-2-propanamine Hydrochloride, R-(-)-Mexiletine HCl, R-(-)-Mexiletine hyrochloide, (2R)-1-(2,6-dimethylphenoxy)propan-2-amine hydrochloride