Products 1329835-60-0
CAS 1329835-60-0 appears in our catalog under these names: Mexiletine-d6 Hydrochloride, Mexiletine D6 hydrochloride, Mexiletine-d6 (hydrochloride), 99.88%. Offered by: TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 5 mg.
1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride (CAS 1329835-60-0) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 221.75 g/mol. IUPAC name: 1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride. InChIKey: NFEIBWMZVIVJLQ-SJPQGYSLSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 221.75 g/mol |
| IUPAC name | 1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride |
| InChIKey | NFEIBWMZVIVJLQ-SJPQGYSLSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])OC1=C(C=CC=C1C)C)N.Cl |
Computed by PubChem (NCBI)