CAS 81771-86-0 appears in our catalog under these names: R-(-)-Mexiletine Hydrochloride, >95% (HPLC), (R)–1–(2,6–Dimethylphenoxy)propan–2–amine hydrochloride, R-(-)-Mexiletine HCl 95%, (R)-1-(2,6-Dimethylphenoxy)propan-2-amine hydrochloride, 95%, 95%, (R)-1-(2,6-Dimethylphenoxy)propan-2-amine hydrochloride, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 1g, 250mg.
(2R)-1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride (CAS 81771-86-0) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: (2R)-1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride. InChIKey: NFEIBWMZVIVJLQ-HNCPQSOCSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | (2R)-1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride |
| InChIKey | NFEIBWMZVIVJLQ-HNCPQSOCSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OC[C@@H](C)N.Cl |
Computed by PubChem (NCBI)