cas: 2301881-38-7 — see every product listed under this CAS number, including other names
(R)-1-(2-Fluoro-4-methylphenyl)ethanamine hydrochloride, 97% (CAS 2301881-38-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch135V48-100mg |
| cas | 2301881-38-7 |
| size | 100mg |
| availability | 7g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1235.60 Pln | |
| Chemat | 1g | 1869.20 Pln | |
| Fluorochem | 100mg | 820.56 Pln | |
| Fluorochem | 250mg | 1325.59 Pln | |
| Fluorochem | 1g | 3205.14 Pln | |
| Fluorochem | 5g | 9208.23 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-(2-fluoro-4-methylphenyl)ethanamine;hydrochloride (CAS 2301881-38-7) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(2-fluoro-4-methylphenyl)ethanamine;hydrochloride. InChIKey: NSYMOBWVKIVIFI-OGFXRTJISA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(2-fluoro-4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | NSYMOBWVKIVIFI-OGFXRTJISA-N |
| SMILES | CC1=CC(=C(C=C1)[C@@H](C)N)F.Cl |
Computed by PubChem (NCBI)