cas: 1213096-70-8 — see every product listed under this CAS number, including other names
(R)-1-(4-Fluoro-3-methylphenyl)ethanamine hydrochloride, 98% (CAS 1213096-70-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A350278-5g |
| cas | 1213096-70-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15472.66 Pln | |
| AmBeed | 10g | 28681.45 Pln | |
| AmBeed | 1g | 6840.40 Pln | |
| Fluorochem | 1g | 3663.31 Pln | |
| Fluorochem | 100mg | 1513.03 Pln | |
| Fluorochem | 250mg | 2137.81 Pln | |
| Fluorochem | 500mg | 2944.81 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride (CAS 1213096-70-8) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride. InChIKey: HZEFSEOLAJTAQO-OGFXRTJISA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | HZEFSEOLAJTAQO-OGFXRTJISA-N |
| SMILES | CC1=C(C=CC(=C1)[C@@H](C)N)F.Cl |
Computed by PubChem (NCBI)