CAS 1376217-48-9 appears in our catalog under these names: 1-(4-Fluoro-3-methylphenyl)ethan-1-amine hydrochloride, 1-(4-Fluoro-3-methylphenyl)ethan-1-amine hydrochloride, 97%, 97%, 1-(4-Fluoro-3-methylphenyl)ethan-1-amine hydrochloride, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 50mg, 500mg, 1g.
1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride (CAS 1376217-48-9) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: 1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride. InChIKey: HZEFSEOLAJTAQO-UHFFFAOYSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | 1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | HZEFSEOLAJTAQO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C)N)F.Cl |
Computed by PubChem (NCBI)