cas: 21752-35-2 — see every product listed under this CAS number, including other names
(R)-2-((1-Phenylethyl)carbamoyl)benzoic acid, 97%, 97% (CAS 21752-35-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C72-250mg |
| cas | 21752-35-2 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1010.00 Pln | |
| Chemat | 25g | 3376.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid (CAS 21752-35-2) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid. InChIKey: VCFKXWGKKDZMPO-LLVKDONJSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 2-[[(1R)-1-phenylethyl]carbamoyl]benzoic acid |
| InChIKey | VCFKXWGKKDZMPO-LLVKDONJSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)