CAS 52950-18-2 appears in our catalog under these names: (R)-(-)-2-Chloromandelic Acid, (R)–(–)–2–Chloromandelic acid, (R)-2-Chloromandelic acid, (R)-2-Chloromandelic acid, 98%, (R)-(-)-2-Chloromandelic acid, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Fluorochem, Chemat. Available pack sizes: 1g, 500mg, 5g, 100g, 500g, 25g, 10g.
(2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid (CAS 52950-18-2) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: (2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid. InChIKey: RWOLDZZTBNYTMS-SSDOTTSWSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | (2R)-2-(2-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | RWOLDZZTBNYTMS-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(=O)O)O)Cl |
Computed by PubChem (NCBI)