CAS 177288-16-3 appears in our catalog under these names: 3-Chlorophenylglyoxal hydrate, 95%, 1-(3-Chlorophenyl)-2,2-dihydroxyethan-1-one. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 200mg, 250mg.
2-(3-chlorophenyl)-2-oxoacetaldehyde;hydrate (CAS 177288-16-3) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(3-chlorophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: QDPIMXWMDQVBKT-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | QDPIMXWMDQVBKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)C=O.O |
Computed by PubChem (NCBI)