Products 1594779-14-2
CAS 1594779-14-2 appears in our catalog under these names: 3-Chloro-4-(hydroxymethyl)benzoic acid, 95%, 3-Chloro-4-(hydroxymethyl)-benzoic Acid, 3-Chloro-4-(hydroxymethyl)benzoic acid. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 5g, 500mg, 0,5g.
3-chloro-4-(hydroxymethyl)benzoic acid (CAS 1594779-14-2) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 3-chloro-4-(hydroxymethyl)benzoic acid. InChIKey: FPXVJBXREBFMGY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 3-chloro-4-(hydroxymethyl)benzoic acid |
| InChIKey | FPXVJBXREBFMGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)CO |
Computed by PubChem (NCBI)