CAS 57479-70-6 appears in our catalog under these names: 4-Chloro-2-methoxybenzoic acid, 98%, 4–Chloro–2–methoxybenzoic Acid, 4-Chloro-2-methoxybenzoic Acid, >98.0%(GC)(T), 4-Chloro-2-methoxybenzoic acid, 4-Chloro-2-methoxybenzoic acid 98%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 25g, 500g, 5g, 1g, 100g, 250g, 1000g, 10g.
4-chloro-2-methoxybenzoic acid (CAS 57479-70-6) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 4-chloro-2-methoxybenzoic acid. InChIKey: UFEYMXHWIHFRBX-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 4-chloro-2-methoxybenzoic acid |
| InChIKey | UFEYMXHWIHFRBX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)