Products 52950-19-3
CAS 52950-19-3 appears in our catalog under these names: Carisbamate Impurity 2, (S)-2-Chloromandelic Acid, 2–Chloro–L–mandelic Acid, 2-Chloro-L-mandelic Acid, >98.0%(GC)(T), (S)-2-(2-Chlorophenyl)-2-hydroxyacetic acid 98%. Offered by: Chemat Brand, TRC, GLPBio, TCI, Ambeed. Available pack sizes: on request, 1g, 2g, 500mg, 100g, 10g, 25g, 5g.
(2S)-2-(2-chlorophenyl)-2-hydroxyacetic acid (CAS 52950-19-3) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: (2S)-2-(2-chlorophenyl)-2-hydroxyacetic acid. InChIKey: RWOLDZZTBNYTMS-ZETCQYMHSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | (2S)-2-(2-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | RWOLDZZTBNYTMS-ZETCQYMHSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](C(=O)O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-(+)-2-Chloromandelic acid, (S)-2-Chloromandelic acid, (2S)-2-(2-chlorophenyl)-2-hydroxyacetic acid, (s)-o-chloromandelic acid, S-(2-chlorophenyl)(hydroxy)acetic acid, Benzeneacetic acid, 2-chloro-alpha-hydroxy-, (alphaS)-, (S)-2-(2-Chlorophenyl)-2-hydroxyacetic acid, 2-Chloro-L-mandelic Acid, S-O-CHLOROMANDELICACID, Zidovudine Impurity A