CAS 859932-64-2 appears in our catalog under these names: 2–(4–chlorophenyl)–2–oxoacetaldehyde–hydrate, 2-(4-Chlorophenyl)-2-oxoacetaldehyde hydrate 97%, 2-(4-Chlorophenyl)-2-oxoacetaldehyde hydrate, 97%, 4-Chlorophenylglyoxal hydrate, min. 95 %, 2 g, 4-Chlorophenylglyoxal hydrate, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Roth, Combi-blocks. Available pack sizes: 1g, 250mg, 5g, 25g, 2g, 100g, 10g, 50g.
2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate (CAS 859932-64-2) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: JTOCXCVDVKZPEB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | JTOCXCVDVKZPEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)Cl.O |
Computed by PubChem (NCBI)