cas: 1630463-92-1 — see every product listed under this CAS number, including other names
(R)-2-(3-Bromophenyl)propanoic acid, 98% (CAS 1630463-92-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A2328784-250mg |
| cas | 1630463-92-1 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 6671.14 Pln | |
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1086.09 Pln | |
| Fluorochem | 10g | 1705.67 Pln | |
| Fluorochem | 25g | 3304.06 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 827.60 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-(3-bromophenyl)propanoic acid (CAS 1630463-92-1) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (2R)-2-(3-bromophenyl)propanoic acid. InChIKey: QLHMQZFTSIHQIT-ZCFIWIBFSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (2R)-2-(3-bromophenyl)propanoic acid |
| InChIKey | QLHMQZFTSIHQIT-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)