CAS 1630463-92-1 is the registry number for (R)-2-(3-Bromophenyl)propanoic acid, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g.
(2R)-2-(3-bromophenyl)propanoic acid (CAS 1630463-92-1) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (2R)-2-(3-bromophenyl)propanoic acid. InChIKey: QLHMQZFTSIHQIT-ZCFIWIBFSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (2R)-2-(3-bromophenyl)propanoic acid |
| InChIKey | QLHMQZFTSIHQIT-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)