Products 1146411-14-4
CAS 1146411-14-4 appears in our catalog under these names: (S)-2-(3-Bromophenyl)propanoic acid, 96%, 96%, (S)-2-(3-Bromophenyl)propanoic acid, 98.30%, (S)-2-(3-Bromophenyl)propanoic acid, 98%, (S)-2-(3-BROMOPHENYL)PROPANOIC ACID, 96%. Offered by: Chemat, MedChemExpress, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 5g, 5 g, 500 mg, 100 mg, 250 mg, 1 g, 250mg, 1g.
(2S)-2-(3-bromophenyl)propanoic acid (CAS 1146411-14-4) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (2S)-2-(3-bromophenyl)propanoic acid. InChIKey: QLHMQZFTSIHQIT-LURJTMIESA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (2S)-2-(3-bromophenyl)propanoic acid |
| InChIKey | QLHMQZFTSIHQIT-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)