Products 53086-52-5
CAS 53086-52-5 appears in our catalog under these names: 2-(3-Bromophenyl)propanoic acid, 96%, 2-(3-Bromophenyl)propanoic acid, 98%, 2–(3–Bromophenyl)Propanoic Acid, 2-(3-Bromophenyl)propanoic acid, 2-(3-Bromophenyl)propanoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 100mg, 250mg.
2-(3-bromophenyl)propanoic acid (CAS 53086-52-5) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(3-bromophenyl)propanoic acid. InChIKey: QLHMQZFTSIHQIT-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-(3-bromophenyl)propanoic acid |
| InChIKey | QLHMQZFTSIHQIT-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)