CAS 61008-98-8 appears in our catalog under these names: (R)-2-(3-Chlorophenyl)-2-hydroxyacetic acid, 98%, 98%, (R)-(-)-3-Chloromandelic Acid, >95% (HPLC), (R)-2-(3-CHLOROPHENYL)-2-HYDROXYACETIC ACID, 98%, (R)-2-(3-Chlorophenyl)-2-hydroxyacetic acid, 95%. Offered by: Chemat, TRC, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
(2R)-2-(3-chlorophenyl)-2-hydroxyacetic acid (CAS 61008-98-8) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: (2R)-2-(3-chlorophenyl)-2-hydroxyacetic acid. InChIKey: SAMVPMGKGGLIPF-SSDOTTSWSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | (2R)-2-(3-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | SAMVPMGKGGLIPF-SSDOTTSWSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](C(=O)O)O |
Computed by PubChem (NCBI)