CAS 16273-37-3 appears in our catalog under these names: 3-Chloromandelic acid 98%, 3–Chloro–DL–mandelic Acid, 3-Chloromandelic acid, 97%, 97%, 2-(3-Chlorophenyl)-2-hydroxyacetic acid, 98%, 3-Chloro-DL-mandelic Acid, >97.0%(GC)(T). Offered by: Ambeed, GLPBio, Chemat, Fluorochem, TCI. Available pack sizes: 5g, 25g, 100g, 500g, 10g, 1g, 50g.
2-(3-chlorophenyl)-2-hydroxyacetic acid (CAS 16273-37-3) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-(3-chlorophenyl)-2-hydroxyacetic acid. InChIKey: SAMVPMGKGGLIPF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-2-hydroxyacetic acid |
| InChIKey | SAMVPMGKGGLIPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C(=O)O)O |
Computed by PubChem (NCBI)