Products 1381928-30-8
CAS 1381928-30-8 appears in our catalog under these names: (R)-2-(4-Fluorophenyl)pyrrolidine hydrochloride, 95%, (R)-2-(4-Fluorophenyl)pyrrolidine hydrochloride, 95%, 95%, (R)-2-(4-Fluorophenyl)pyrrolidine hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2R)-2-(4-fluorophenyl)pyrrolidine;hydrochloride (CAS 1381928-30-8) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: (2R)-2-(4-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: WOZFKQCJNIDQPL-HNCPQSOCSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (2R)-2-(4-fluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | WOZFKQCJNIDQPL-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)