Products 1159825-73-6
CAS 1159825-73-6 appears in our catalog under these names: 1-(4-Fluorophenyl)but-3-enylamine hydrochloride, 95%, 1–(4–Fluorophenyl)but–3–enylamine hcl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
1-(4-fluorophenyl)but-3-en-1-amine;hydrochloride (CAS 1159825-73-6) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 1-(4-fluorophenyl)but-3-en-1-amine;hydrochloride. InChIKey: TXYCZYDHHPXNIK-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 1-(4-fluorophenyl)but-3-en-1-amine;hydrochloride |
| InChIKey | TXYCZYDHHPXNIK-UHFFFAOYSA-N |
| SMILES | C=CCC(C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)