CAS 1360442-16-5 appears in our catalog under these names: (S)-2-(3-Fluorophenyl)pyrrolidine hydrochloride, 95%, (S)–2–(3–Fluorophenyl)pyrrolidine hydrochloride, (S)-2-(3-Fluorophenyl)pyrrolidine hydrochloride 97%, (S)-2-(3-Fluorophenyl)pyrrolidine hydrochloride, 97%, 97%, (S)-2-(3-Fluorophenyl)pyrrolidine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg.
(2S)-2-(3-fluorophenyl)pyrrolidine;hydrochloride (CAS 1360442-16-5) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: (2S)-2-(3-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: IXZAULRSYOOKSM-PPHPATTJSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (2S)-2-(3-fluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | IXZAULRSYOOKSM-PPHPATTJSA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)