Products 943843-61-6

CAS 943843-61-6 is the registry number for 3-(3-Fluorophenyl)pyrrolidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-(3-fluorophenyl)pyrrolidine;hydrochloride (CAS 943843-61-6) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 3-(3-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: RYJQGVVTJUSCFM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClFN
Molecular weight201.67 g/mol
IUPAC name3-(3-fluorophenyl)pyrrolidine;hydrochloride
InChIKeyRYJQGVVTJUSCFM-UHFFFAOYSA-N
SMILESC1CNCC1C2=CC(=CC=C2)F.Cl

Computed by PubChem (NCBI)