CAS 844470-82-2 appears in our catalog under these names: (S)–Cyclopropyl(2–fluorophenyl)methanamine hydrochloride, (S)-Cyclopropyl(2-fluorophenyl)methanaminehydrochloride, 95%, (S)-Cyclopropyl(2-fluorophenyl)methanamine hydrochloride, 95%, Benzenemethanamine, α-cyclopropyl-2-fluoro-, hydrochloride (1:1), (αS)-, 97%, 97%. Offered by: GLPBio, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
(S)-cyclopropyl-(2-fluorophenyl)methanamine;hydrochloride (CAS 844470-82-2) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: (S)-cyclopropyl-(2-fluorophenyl)methanamine;hydrochloride. InChIKey: ZERUEQOFZLOJJX-PPHPATTJSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (S)-cyclopropyl-(2-fluorophenyl)methanamine;hydrochloride |
| InChIKey | ZERUEQOFZLOJJX-PPHPATTJSA-N |
| SMILES | C1CC1[C@@H](C2=CC=CC=C2F)N.Cl |
Computed by PubChem (NCBI)