CAS 1193390-31-6 appears in our catalog under these names: 2-(3-Fluorophenyl)pyrrolidine hydrochloride, 95%, 2-(3-Fluorophenyl)pyrrolidine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g.
2-(3-fluorophenyl)pyrrolidine;hydrochloride (CAS 1193390-31-6) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 2-(3-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: IXZAULRSYOOKSM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 2-(3-fluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | IXZAULRSYOOKSM-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)