cas: 86123-95-7 — see every product listed under this CAS number, including other names
(R)-2-(tert-Butoxycarbonylamino)-3-methoxypropionic acid, 97%, 97% (CAS 86123-95-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145K4-1g |
| cas | 86123-95-7 |
| size | 1g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 50g | 453.20 Pln | |
| Chemat | 100g | 846.80 Pln | |
| Chemat | 500g | 3940.80 Pln | |
| Chemat | 1kg | 7797.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 86123-95-7) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RFGMSGRWQUMJIR-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RFGMSGRWQUMJIR-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](COC)C(=O)O |
Computed by PubChem (NCBI)