cas: 86123-95-7 — see every product listed under this CAS number, including other names
Boc-o-Methyl-D-serine, 95% (CAS 86123-95-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047555-1G |
| cas | 86123-95-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 216.61 Pln | |
| Fluorochem | 25g | 378.01 Pln | |
| Fluorochem | 100g | 1247.50 Pln | |
| Fluorochem | 500g | 4220.41 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 86123-95-7) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RFGMSGRWQUMJIR-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RFGMSGRWQUMJIR-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](COC)C(=O)O |
Computed by PubChem (NCBI)