(R)-2-Amino-2-(2-Methoxyphenyl)Acetic Acid, 95%
cas: 103889-84-5 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(2-Methoxyphenyl)Acetic Acid, 95% (CAS 103889-84-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch118WYZ-100mg |
| cas | 103889-84-5 |
| size | 100mg |
| availability | 25g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1706.00 Pln | |
| Chemat | 5g | 6016.40 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 730.88 Pln | |
| BLDpharm | 1g | 2052.64 Pln | |
| BLDpharm | 5g | 7178.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-2-(2-methoxyphenyl)acetic acid (CAS 103889-84-5) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R)-2-amino-2-(2-methoxyphenyl)acetic acid. InChIKey: DQSACLYOIBPCJU-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-methoxyphenyl)acetic acid |
| InChIKey | DQSACLYOIBPCJU-MRVPVSSYSA-N |
| SMILES | COC1=CC=CC=C1[C@H](C(=O)O)N |
Computed by PubChem (NCBI)