CAS 103889-86-7 appears in our catalog under these names: (S)-Amino-(2-methoxy-phenyl)-acetic acid, 97%, (S)-2-Amino-2-(2-methoxyphenyl)acetic acid 97%, (S)-AMINO-(2-METHOXY-PHENYL)-ACETIC ACID, 97%, 97%, (S)-2-Amino-2-(2-methoxyphenyl)acetic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2S)-2-amino-2-(2-methoxyphenyl)acetic acid (CAS 103889-86-7) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2S)-2-amino-2-(2-methoxyphenyl)acetic acid. InChIKey: DQSACLYOIBPCJU-QMMMGPOBSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2S)-2-amino-2-(2-methoxyphenyl)acetic acid |
| InChIKey | DQSACLYOIBPCJU-QMMMGPOBSA-N |
| SMILES | COC1=CC=CC=C1[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)