cas: 736184-44-4 — see every product listed under this CAS number, including other names
(R)-2-Amino-3-(2-iodophenyl)propanoic acid, 97% (CAS 736184-44-4) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243183-500MG |
| cas | 736184-44-4 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1174.60 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 6683.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-amino-3-(2-iodophenyl)propanoic acid (CAS 736184-44-4) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: (2R)-2-amino-3-(2-iodophenyl)propanoic acid. InChIKey: BKXVGLPBXYBDDM-MRVPVSSYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-iodophenyl)propanoic acid |
| InChIKey | BKXVGLPBXYBDDM-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)N)I |
Computed by PubChem (NCBI)