CAS 1986-86-3 appears in our catalog under these names: 2-AMINO-3-(2-IODOPHENYL)PROPANOIC ACID, 98%, 2-Amino-3-(2-iodophenyl)propanoic acid, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 100mg.
2-amino-3-(2-iodophenyl)propanoic acid (CAS 1986-86-3) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: 2-amino-3-(2-iodophenyl)propanoic acid. InChIKey: BKXVGLPBXYBDDM-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | 2-amino-3-(2-iodophenyl)propanoic acid |
| InChIKey | BKXVGLPBXYBDDM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)N)I |
Computed by PubChem (NCBI)