cas: 500788-88-5 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-3-(2-hydroxyphenyl)propanoic acid, 95+%, 95+% (CAS 500788-88-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D90W-250mg |
| cas | 500788-88-5 |
| size | 250mg |
| availability | 5.02g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 746.00 Pln | |
| Chemat | 5g | 2118.80 Pln | |
| Chemat | 100mg | 275.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-(2-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 500788-88-5) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (3R)-3-(2-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KWISQTDJMMIQCM-SNVBAGLBSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (3R)-3-(2-hydroxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KWISQTDJMMIQCM-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC=CC=C1O |
Computed by PubChem (NCBI)