CAS 679785-24-1 appears in our catalog under these names: 2-[(2,2-Dimethylpropanoyl)amino]-4,5-dimethoxybenzoic acid, 95%, 2-(2,2-Dimethylpropanamido)-4,5-dimethoxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2,2-dimethylpropanoylamino)-4,5-dimethoxybenzoic acid (CAS 679785-24-1) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-4,5-dimethoxybenzoic acid. InChIKey: YJAYHMAKUYQNPU-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-4,5-dimethoxybenzoic acid |
| InChIKey | YJAYHMAKUYQNPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=CC(=C(C=C1C(=O)O)OC)OC |
Computed by PubChem (NCBI)