CAS 1003589-78-3 appears in our catalog under these names: 2-Pyridineacetic acid, 3-(ethoxycarbonyl)-6-methoxy-alpha-methyl-, ethyl ester, 95%, 2-Pyridineacetic acid, 3-(ethoxycarbonyl)-6-methoxy-α-methyl-, ethyl ester, 98%, 2–pyridineacetic acid, 3–(ethoxycarbonyl)–6–methoxy–α–methyl–, ethyl ester, 2-Pyridineacetic acid, 3-(ethoxycarbonyl)-6-methoxy-α-methyl-, ethyl ester, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg.
Ethyl 2-(1-ethoxy-1-oxopropan-2-yl)-6-methoxypyridine-3-carboxylate (CAS 1003589-78-3) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: ethyl 2-(1-ethoxy-1-oxopropan-2-yl)-6-methoxypyridine-3-carboxylate. InChIKey: FWOKSSFABOOZSU-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | ethyl 2-(1-ethoxy-1-oxopropan-2-yl)-6-methoxypyridine-3-carboxylate |
| InChIKey | FWOKSSFABOOZSU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)OC)C(C)C(=O)OCC |
Computed by PubChem (NCBI)