CAS 1397000-89-3 appears in our catalog under these names: 2-((3,5-Dimethoxyphenyl)formamido)-3-methylbutanoic acid, 95%, 2-(3,5-Dimethoxy-benzoylamino)-3-methyl-butyric acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoic acid (CAS 1397000-89-3) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoic acid. InChIKey: GIFFRTRRFQTLQS-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 2-[(3,5-dimethoxybenzoyl)amino]-3-methylbutanoic acid |
| InChIKey | GIFFRTRRFQTLQS-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)O)NC(=O)C1=CC(=CC(=C1)OC)OC |
Computed by PubChem (NCBI)