CAS 40512-37-6 appears in our catalog under these names: (N-BOC-Amino)(3-methoxyphenyl)acetic acid, 98%, (N–BOC–Amino)(3–methoxyphenyl)acetic acid, 2-{((tert-butoxy)carbonyl)amino}-2-(3-methoxyphenyl)acetic acid, 2-((Tert-butoxycarbonyl)amino)-2-(3-methoxyphenyl)acetic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 0,5g, 500mg.
2-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 40512-37-6) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 2-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZPMHSWFMWHVVHG-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZPMHSWFMWHVVHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC(=CC=C1)OC)C(=O)O |
Computed by PubChem (NCBI)