Products 350699-64-8

CAS 350699-64-8 is the registry number for 3-(4-tert-Butoxycarbonylaminophenoxy)propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]propanoic acid (CAS 350699-64-8) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]propanoic acid. InChIKey: YBWCDMOFWXTMOK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO5
Molecular weight281.30 g/mol
IUPAC name3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]propanoic acid
InChIKeyYBWCDMOFWXTMOK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC=C(C=C1)OCCC(=O)O

Computed by PubChem (NCBI)